* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A033 |
English Synonyms: | WUXI-NATURAL 102_Y01A033 |
MDL Number.: | MFCD21333904 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1Cl)c2[nH]c3c(n2)C(C4CC[C@@]5(C([C@]4(C3)C)CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)(C)C |
InChi: | InChI=1S/C39H53ClN2O2/c1-23-10-11-24(20-27(23)40)32-41-28-22-36(6)29(35(4,5)31(28)42-32)14-15-38(8)30(36)13-12-25-26-21-34(2,3)16-18-39(26,33(43)44-9)19-17-37(25,38)7/h10-12,20,26,29-30H,13-19,21-22H2,1-9H3,(H,41,42)/t26?,29?,30?,36-,37+,38+,39-/m0/s1 |
InChiKey: | InChIKey=CXVFIZYDLNBWQF-AGXQAJKRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.