* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 102_Y01A038 |
| English Synonyms: | WUXI-NATURAL 102_Y01A038 |
| MDL Number.: | MFCD21333909 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1C)c2[nH]c3c(n2)C(C4CC[C@@]5(C([C@]4(C3)C)CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)(C)C |
| InChi: | InChI=1S/C40H56N2O2/c1-24-11-12-26(21-25(24)2)33-41-29-23-37(7)30(36(5,6)32(29)42-33)15-16-39(9)31(37)14-13-27-28-22-35(3,4)17-19-40(28,34(43)44-10)20-18-38(27,39)8/h11-13,21,28,30-31H,14-20,22-23H2,1-10H3,(H,41,42)/t28?,30?,31?,37-,38+,39+,40-/m0/s1 |
| InChiKey: | InChIKey=YJLAKQSVGVKXMB-YFURRWFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.