* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A043 |
English Synonyms: | WUXI-NATURAL 102_Y01A043 |
MDL Number.: | MFCD21333914 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(C)c1[nH]c2c(n1)C(C3CC[C@@]4(C([C@]3(C2)C)CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)(C)C |
InChi: | InChI=1S/C36H56N2O2/c1-11-22(2)29-37-25-21-33(7)26(32(5,6)28(25)38-29)14-15-35(9)27(33)13-12-23-24-20-31(3,4)16-18-36(24,30(39)40-10)19-17-34(23,35)8/h12,22,24,26-27H,11,13-21H2,1-10H3,(H,37,38)/t22?,24?,26?,27?,33-,34+,35+,36-/m0/s1 |
InChiKey: | InChIKey=DONCZUFZVCACHM-NQTSXVKJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.