* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A062 |
English Synonyms: | WUXI-NATURAL 102_Y01A062 |
MDL Number.: | MFCD21333933 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1ccc(cc1)c2[nH]c3c(n2)C(C4CC[C@@]5(C([C@]4(C3)C)CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)(C)C |
InChi: | InChI=1S/C40H56N2O2/c1-10-25-11-13-26(14-12-25)33-41-29-24-37(6)30(36(4,5)32(29)42-33)17-18-39(8)31(37)16-15-27-28-23-35(2,3)19-21-40(28,34(43)44-9)22-20-38(27,39)7/h11-15,28,30-31H,10,16-24H2,1-9H3,(H,41,42)/t28?,30?,31?,37-,38+,39+,40-/m0/s1 |
InChiKey: | InChIKey=ZVIKTHOQOHSNHJ-YFURRWFRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.