* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A063 |
English Synonyms: | WUXI-NATURAL 102_Y01A063 |
MDL Number.: | MFCD21333934 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)c7cc(ccc7Cl)[N+](=O)[O-])C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C38H50ClN3O4/c1-33(2)15-17-38(32(43)46-8)18-16-36(6)24(25(38)20-33)10-12-29-35(5)21-27-30(34(3,4)28(35)13-14-37(29,36)7)41-31(40-27)23-19-22(42(44)45)9-11-26(23)39/h9-11,19,25,28-29H,12-18,20-21H2,1-8H3,(H,40,41)/t25?,28?,29?,35-,36+,37+,38-/m0/s1 |
InChiKey: | InChIKey=MJTAFQPDMHRVDF-UMNZFSRFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.