* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A064 |
English Synonyms: | WUXI-NATURAL 102_Y01A064 |
MDL Number.: | MFCD21333935 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)CCCc7ccccc7)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C41H58N2O2/c1-36(2)21-23-41(35(44)45-8)24-22-39(6)28(29(41)25-36)17-18-32-38(5)26-30-34(37(3,4)31(38)19-20-40(32,39)7)43-33(42-30)16-12-15-27-13-10-9-11-14-27/h9-11,13-14,17,29,31-32H,12,15-16,18-26H2,1-8H3,(H,42,43)/t29?,31?,32?,38-,39+,40+,41-/m0/s1 |
InChiKey: | InChIKey=BKLBRTHIYGMHLR-WPQVYLORSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.