* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 102_Y01A065 |
| English Synonyms: | WUXI-NATURAL 102_Y01A065 |
| MDL Number.: | MFCD21333936 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)Cc7ccc8ccccc8c7)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C43H56N2O2/c1-38(2)19-21-43(37(46)47-8)22-20-41(6)30(31(43)25-38)15-16-34-40(5)26-32-36(39(3,4)33(40)17-18-42(34,41)7)45-35(44-32)24-27-13-14-28-11-9-10-12-29(28)23-27/h9-15,23,31,33-34H,16-22,24-26H2,1-8H3,(H,44,45)/t31?,33?,34?,40-,41+,42+,43-/m0/s1 |
| InChiKey: | InChIKey=LDZLMJCWHJADTH-RWMGMGMASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.