* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 102_Y01A068 |
| English Synonyms: | WUXI-NATURAL 102_Y01A068 |
| MDL Number.: | MFCD21333939 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)Cc7cccc(c7)Br)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C39H53BrN2O2/c1-34(2)16-18-39(33(43)44-8)19-17-37(6)26(27(39)22-34)12-13-30-36(5)23-28-32(35(3,4)29(36)14-15-38(30,37)7)42-31(41-28)21-24-10-9-11-25(40)20-24/h9-12,20,27,29-30H,13-19,21-23H2,1-8H3,(H,41,42)/t27?,29?,30?,36-,37+,38+,39-/m0/s1 |
| InChiKey: | InChIKey=MVACMINOEBLYHN-JQVAVUSUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.