* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 102_Y01A070 |
| English Synonyms: | WUXI-NATURAL 102_Y01A070 |
| MDL Number.: | MFCD21333941 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1cccnc1c2[nH]c3c(n2)C(C4CC[C@@]5(C([C@]4(C3)C)CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)(C)C |
| InChi: | InChI=1S/C38H53N3O2/c1-23-11-10-20-39-29(23)31-40-26-22-35(6)27(34(4,5)30(26)41-31)14-15-37(8)28(35)13-12-24-25-21-33(2,3)16-18-38(25,32(42)43-9)19-17-36(24,37)7/h10-12,20,25,27-28H,13-19,21-22H2,1-9H3,(H,40,41)/t25?,27?,28?,35-,36+,37+,38-/m0/s1 |
| InChiKey: | InChIKey=ORDWOIOKTIKBLM-DMKBLCABSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.