* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 102_Y01A071 |
English Synonyms: | WUXI-NATURAL 102_Y01A071 |
MDL Number.: | MFCD21333942 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(Cc6c(nc([nH]6)c7c(cc(cn7)F)F)C5(C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C37H49F2N3O2/c1-32(2)13-15-37(31(43)44-8)16-14-35(6)22(23(37)18-32)9-10-27-34(5)19-25-29(33(3,4)26(34)11-12-36(27,35)7)42-30(41-25)28-24(39)17-21(38)20-40-28/h9,17,20,23,26-27H,10-16,18-19H2,1-8H3,(H,41,42)/t23?,26?,27?,34-,35+,36+,37-/m0/s1 |
InChiKey: | InChIKey=FYVNNTCOXKUXLV-QFJAYFKKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.