* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A003 |
English Synonyms: | WUXI-NATURAL 103_Y01A003 |
MDL Number.: | MFCD21333946 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6Cc7ccoc7)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C38H58N2O3/c1-33(2)14-16-38(32(41)42-8)17-15-36(6)26(27(38)21-33)9-10-30-35(5)22-28-31(34(3,4)29(35)11-13-37(30,36)7)39-18-19-40(28)23-25-12-20-43-24-25/h9,12,20,24,27-31,39H,10-11,13-19,21-23H2,1-8H3/t27?,28-,29?,30?,31-,35+,36-,37-,38+/m1/s1 |
InChiKey: | InChIKey=AXDFJLPILXLQGU-QSPMAXJGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.