* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A006 |
English Synonyms: | WUXI-NATURAL 103_Y01A006 |
MDL Number.: | MFCD21333949 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1ccc(o1)CN2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C39H60N2O3/c1-25-10-11-26(44-25)24-41-21-20-40-32-29(41)23-36(6)30(35(32,4)5)14-15-38(8)31(36)13-12-27-28-22-34(2,3)16-18-39(28,33(42)43-9)19-17-37(27,38)7/h10-12,28-32,40H,13-24H2,1-9H3/t28?,29-,30?,31?,32-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=WIXVTFSBZQEWNV-JIXNTIAGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.