* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A007 |
English Synonyms: | WUXI-NATURAL 103_Y01A007 |
MDL Number.: | MFCD21333950 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCc1ccc(o1)CN2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C40H62N2O3/c1-10-26-11-12-27(45-26)25-42-22-21-41-33-30(42)24-37(6)31(36(33,4)5)15-16-39(8)32(37)14-13-28-29-23-35(2,3)17-19-40(29,34(43)44-9)20-18-38(28,39)7/h11-13,29-33,41H,10,14-25H2,1-9H3/t29?,30-,31?,32?,33-,37+,38-,39-,40+/m1/s1 |
InChiKey: | InChIKey=HPABCSODTJYNFG-JCLLMELSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.