* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A011 |
English Synonyms: | WUXI-NATURAL 103_Y01A011 |
MDL Number.: | MFCD21333954 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6Cc7ccc(cc7)F)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C40H59FN2O2/c1-35(2)17-19-40(34(44)45-8)20-18-38(6)28(29(40)23-35)13-14-32-37(5)24-30-33(36(3,4)31(37)15-16-39(32,38)7)42-21-22-43(30)25-26-9-11-27(41)12-10-26/h9-13,29-33,42H,14-25H2,1-8H3/t29?,30-,31?,32?,33-,37+,38-,39-,40+/m1/s1 |
InChiKey: | InChIKey=SMBBVDKSOQLGCD-JCLLMELSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.