* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y01A012 |
| English Synonyms: | WUXI-NATURAL 103_Y01A012 |
| MDL Number.: | MFCD21333955 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6Cc7ccc(cc7)OC)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C41H62N2O3/c1-36(2)18-20-41(35(44)46-9)21-19-39(6)29(30(41)24-36)14-15-33-38(5)25-31-34(37(3,4)32(38)16-17-40(33,39)7)42-22-23-43(31)26-27-10-12-28(45-8)13-11-27/h10-14,30-34,42H,15-26H2,1-9H3/t30?,31-,32?,33?,34-,38+,39-,40-,41+/m1/s1 |
| InChiKey: | InChIKey=ZCVCUYMLXYPKRL-NTXKOIRTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.