* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y01A015 |
| English Synonyms: | WUXI-NATURAL 103_Y01A015 |
| MDL Number.: | MFCD21333958 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6Cc7cccc(c7)C#N)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C41H59N3O2/c1-36(2)16-18-41(35(45)46-8)19-17-39(6)29(30(41)23-36)12-13-33-38(5)24-31-34(37(3,4)32(38)14-15-40(33,39)7)43-20-21-44(31)26-28-11-9-10-27(22-28)25-42/h9-12,22,30-34,43H,13-21,23-24,26H2,1-8H3/t30?,31-,32?,33?,34-,38+,39-,40-,41+/m1/s1 |
| InChiKey: | InChIKey=YSSGKQKEWURABR-NTXKOIRTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.