* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y01A016 |
| English Synonyms: | WUXI-NATURAL 103_Y01A016 |
| MDL Number.: | MFCD21333959 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6Cc7ccccn7)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C39H59N3O2/c1-34(2)16-18-39(33(43)44-8)19-17-37(6)27(28(39)23-34)12-13-31-36(5)24-29-32(35(3,4)30(36)14-15-38(31,37)7)41-21-22-42(29)25-26-11-9-10-20-40-26/h9-12,20,28-32,41H,13-19,21-25H2,1-8H3/t28?,29-,30?,31?,32-,36+,37-,38-,39+/m1/s1 |
| InChiKey: | InChIKey=XTZPSFNJPDOMGN-JIXNTIAGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.