* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A020 |
English Synonyms: | WUXI-NATURAL 103_Y01A020 |
MDL Number.: | MFCD21333963 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6Cc7cccnc7OC)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C40H61N3O3/c1-35(2)16-18-40(34(44)46-9)19-17-38(6)27(28(40)23-35)12-13-31-37(5)24-29-32(36(3,4)30(37)14-15-39(31,38)7)41-21-22-43(29)25-26-11-10-20-42-33(26)45-8/h10-12,20,28-32,41H,13-19,21-25H2,1-9H3/t28?,29-,30?,31?,32-,37+,38-,39-,40+/m1/s1 |
InChiKey: | InChIKey=MYXYAAXRPLPPTO-AKSVDIMISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.