* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A022 |
English Synonyms: | WUXI-NATURAL 103_Y01A022 |
MDL Number.: | MFCD21333965 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1cnc(nc1)N2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C38H58N4O2/c1-24-22-40-32(41-23-24)42-19-18-39-30-27(42)21-35(6)28(34(30,4)5)12-13-37(8)29(35)11-10-25-26-20-33(2,3)14-16-38(26,31(43)44-9)17-15-36(25,37)7/h10,22-23,26-30,39H,11-21H2,1-9H3/t26?,27-,28?,29?,30-,35+,36-,37-,38+/m1/s1 |
InChiKey: | InChIKey=CXRUCLGURNWQEQ-XYJSODIWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.