* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A025 |
English Synonyms: | WUXI-NATURAL 103_Y01A025 |
MDL Number.: | MFCD21333968 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6C(=O)c7ccco7)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C38H56N2O4/c1-33(2)15-17-38(32(42)43-8)18-16-36(6)24(25(38)22-33)11-12-29-35(5)23-26-30(34(3,4)28(35)13-14-37(29,36)7)39-19-20-40(26)31(41)27-10-9-21-44-27/h9-11,21,25-26,28-30,39H,12-20,22-23H2,1-8H3/t25?,26-,28?,29?,30-,35+,36-,37-,38+/m1/s1 |
InChiKey: | InChIKey=UMRAPCRXMVITOF-GNENCVKVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.