* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A046 |
English Synonyms: | WUXI-NATURAL 103_Y01A046 |
MDL Number.: | MFCD21333989 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1ccoc1C(=O)N2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C39H58N2O4/c1-24-13-21-45-30(24)32(42)41-20-19-40-31-27(41)23-36(6)28(35(31,4)5)12-14-38(8)29(36)11-10-25-26-22-34(2,3)15-17-39(26,33(43)44-9)18-16-37(25,38)7/h10,13,21,26-29,31,40H,11-12,14-20,22-23H2,1-9H3/t26?,27-,28?,29?,31-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=XQUOSZFGXTZCBY-QFVMHNQDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.