* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y01A048 |
| English Synonyms: | WUXI-NATURAL 103_Y01A048 |
| MDL Number.: | MFCD21333991 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(n1)C(=O)N2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
| InChi: | InChI=1S/C40H59N3O3/c1-25-11-10-12-28(42-25)33(44)43-22-21-41-32-29(43)24-37(6)30(36(32,4)5)15-16-39(8)31(37)14-13-26-27-23-35(2,3)17-19-40(27,34(45)46-9)20-18-38(26,39)7/h10-13,27,29-32,41H,14-24H2,1-9H3/t27?,29-,30?,31?,32-,37+,38-,39-,40+/m1/s1 |
| InChiKey: | InChIKey=OGJQBELXPCSKJK-KEDKBBOVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.