* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A049 |
English Synonyms: | WUXI-NATURAL 103_Y01A049 |
MDL Number.: | MFCD21333992 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1cc(cnc1)C(=O)N2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C40H59N3O3/c1-25-20-26(24-41-23-25)33(44)43-19-18-42-32-29(43)22-37(6)30(36(32,4)5)12-13-39(8)31(37)11-10-27-28-21-35(2,3)14-16-40(28,34(45)46-9)17-15-38(27,39)7/h10,20,23-24,28-32,42H,11-19,21-22H2,1-9H3/t28?,29-,30?,31?,32-,37+,38-,39-,40+/m1/s1 |
InChiKey: | InChIKey=FVFADZKFOVGOOD-AKSVDIMISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.