* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A059 |
English Synonyms: | WUXI-NATURAL 103_Y01A059 |
MDL Number.: | MFCD21334002 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6C(=O)c7ccncc7F)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H56FN3O3/c1-34(2)14-16-39(33(45)46-8)17-15-37(6)25(26(39)21-34)9-10-30-36(5)22-28-31(35(3,4)29(36)11-13-38(30,37)7)42-19-20-43(28)32(44)24-12-18-41-23-27(24)40/h9,12,18,23,26,28-31,42H,10-11,13-17,19-22H2,1-8H3/t26?,28-,29?,30?,31-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=ITHYJBNLTUMALH-WDGCEJSXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.