* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y01A070 |
| English Synonyms: | WUXI-NATURAL 103_Y01A070 |
| MDL Number.: | MFCD21334013 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1F)C(=O)N2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
| InChi: | InChI=1S/C41H59FN2O3/c1-25-10-11-26(22-29(25)42)34(45)44-21-20-43-33-30(44)24-38(6)31(37(33,4)5)14-15-40(8)32(38)13-12-27-28-23-36(2,3)16-18-41(28,35(46)47-9)19-17-39(27,40)7/h10-12,22,28,30-33,43H,13-21,23-24H2,1-9H3/t28?,30-,31?,32?,33-,38+,39-,40-,41+/m1/s1 |
| InChiKey: | InChIKey=LIJYDQOKCSYABJ-PRVDHORSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.