* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y01A071 |
| English Synonyms: | WUXI-NATURAL 103_Y01A071 |
| MDL Number.: | MFCD21334014 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)S(=O)(=O)N2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
| InChi: | InChI=1S/C40H60N2O4S/c1-26-10-12-27(13-11-26)47(44,45)42-23-22-41-33-30(42)25-37(6)31(36(33,4)5)16-17-39(8)32(37)15-14-28-29-24-35(2,3)18-20-40(29,34(43)46-9)21-19-38(28,39)7/h10-14,29-33,41H,15-25H2,1-9H3/t29?,30-,31?,32?,33-,37+,38-,39-,40+/m1/s1 |
| InChiKey: | InChIKey=ZXQQFQGMHKEJJC-JCLLMELSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.