* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A074 |
English Synonyms: | WUXI-NATURAL 103_Y01A074 |
MDL Number.: | MFCD21334017 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1)CN2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C41H62N2O2/c1-27-11-10-12-28(23-27)26-43-22-21-42-34-31(43)25-38(6)32(37(34,4)5)15-16-40(8)33(38)14-13-29-30-24-36(2,3)17-19-41(30,35(44)45-9)20-18-39(29,40)7/h10-13,23,30-34,42H,14-22,24-26H2,1-9H3/t30?,31-,32?,33?,34-,38+,39-,40-,41+/m1/s1 |
InChiKey: | InChIKey=HSBORAFZLKIYHZ-NTXKOIRTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.