* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A075 |
English Synonyms: | WUXI-NATURAL 103_Y01A075 |
MDL Number.: | MFCD21334018 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1C)CN2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C42H64N2O2/c1-27-11-12-29(23-28(27)2)26-44-22-21-43-35-32(44)25-39(7)33(38(35,5)6)15-16-41(9)34(39)14-13-30-31-24-37(3,4)17-19-42(31,36(45)46-10)20-18-40(30,41)8/h11-13,23,31-35,43H,14-22,24-26H2,1-10H3/t31?,32-,33?,34?,35-,39+,40-,41-,42+/m1/s1 |
InChiKey: | InChIKey=JMMACVLAOHJYQQ-SNHVRQNRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.