* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A077 |
English Synonyms: | WUXI-NATURAL 103_Y01A077 |
MDL Number.: | MFCD21334020 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc(oc1C)CN2CCN[C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C40H62N2O3/c1-25-21-27(45-26(25)2)24-42-20-19-41-33-30(42)23-37(7)31(36(33,5)6)13-14-39(9)32(37)12-11-28-29-22-35(3,4)15-17-40(29,34(43)44-10)18-16-38(28,39)8/h11,21,29-33,41H,12-20,22-24H2,1-10H3/t29?,30-,31?,32?,33-,37+,38-,39-,40+/m1/s1 |
InChiKey: | InChIKey=MXPHCUZNVCETBZ-JCLLMELSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.