* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A079 |
English Synonyms: | WUXI-NATURAL 103_Y01A079 |
MDL Number.: | MFCD21334022 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6CC7CC7)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C37H60N2O2/c1-32(2)15-17-37(31(40)41-8)18-16-35(6)25(26(37)21-32)11-12-29-34(5)22-27-30(38-19-20-39(27)23-24-9-10-24)33(3,4)28(34)13-14-36(29,35)7/h11,24,26-30,38H,9-10,12-23H2,1-8H3/t26?,27-,28?,29?,30-,34+,35-,36-,37+/m1/s1 |
InChiKey: | InChIKey=WCCUHOMZAYGJSN-DEMIQVAFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.