* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A085 |
English Synonyms: | WUXI-NATURAL 103_Y01A085 |
MDL Number.: | MFCD21334028 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCC(=O)N1CCN[C@@H]2[C@H]1C[C@]3(C(C2(C)C)CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C36H58N2O3/c1-10-28(39)38-20-19-37-29-25(38)22-33(6)26(32(29,4)5)13-14-35(8)27(33)12-11-23-24-21-31(2,3)15-17-36(24,30(40)41-9)18-16-34(23,35)7/h11,24-27,29,37H,10,12-22H2,1-9H3/t24?,25-,26?,27?,29-,33+,34-,35-,36+/m1/s1 |
InChiKey: | InChIKey=LCXKIAMYTWSCJT-XMPOZJBYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.