* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A087 |
English Synonyms: | WUXI-NATURAL 103_Y01A087 |
MDL Number.: | MFCD21334030 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCC(=O)N1CCN[C@@H]2[C@H]1C[C@]3(C(C2(C)C)CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C37H60N2O3/c1-10-11-29(40)39-21-20-38-30-26(39)23-34(6)27(33(30,4)5)14-15-36(8)28(34)13-12-24-25-22-32(2,3)16-18-37(25,31(41)42-9)19-17-35(24,36)7/h12,25-28,30,38H,10-11,13-23H2,1-9H3/t25?,26-,27?,28?,30-,34+,35-,36-,37+/m1/s1 |
InChiKey: | InChIKey=MIONNGBLFXUWOS-KOIYQHFOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.