* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A092 |
English Synonyms: | WUXI-NATURAL 103_Y01A092 |
MDL Number.: | MFCD21334035 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)NCCN6C(=O)COC)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C36H58N2O4/c1-31(2)14-16-36(30(40)42-9)17-15-34(6)23(24(36)20-31)10-11-27-33(5)21-25-29(37-18-19-38(25)28(39)22-41-8)32(3,4)26(33)12-13-35(27,34)7/h10,24-27,29,37H,11-22H2,1-9H3/t24?,25-,26?,27?,29-,33+,34-,35-,36+/m1/s1 |
InChiKey: | InChIKey=PKMANLPOASKBKJ-XMPOZJBYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.