* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A097 |
English Synonyms: | WUXI-NATURAL 103_Y01A097 |
MDL Number.: | MFCD21334040 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCCS(=O)(=O)N1CCN[C@@H]2[C@H]1C[C@]3(C(C2(C)C)CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C36H60N2O4S/c1-10-21-43(40,41)38-20-19-37-29-26(38)23-33(6)27(32(29,4)5)13-14-35(8)28(33)12-11-24-25-22-31(2,3)15-17-36(25,30(39)42-9)18-16-34(24,35)7/h11,25-29,37H,10,12-23H2,1-9H3/t25?,26-,27?,28?,29-,33+,34-,35-,36+/m1/s1 |
InChiKey: | InChIKey=ZNBQPPLZGMAZJS-XUYPVFJASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.