* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y01A099 |
English Synonyms: | WUXI-NATURAL 103_Y01A099 |
MDL Number.: | MFCD21334042 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)NC(=O)N1CCN[C@@H]2[C@H]1C[C@]3(C(C2(C)C)CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C |
InChi: | InChI=1S/C37H61N3O3/c1-23(2)39-31(42)40-20-19-38-29-26(40)22-34(7)27(33(29,5)6)13-14-36(9)28(34)12-11-24-25-21-32(3,4)15-17-37(25,30(41)43-10)18-16-35(24,36)8/h11,23,25-29,38H,12-22H2,1-10H3,(H,39,42)/t25?,26-,27?,28?,29-,34+,35-,36-,37+/m1/s1 |
InChiKey: | InChIKey=SYLNJPBHVCICDD-GPHOGFQFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.