* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A003 |
English Synonyms: | WUXI-NATURAL 103_Y02A003 |
MDL Number.: | MFCD21334051 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6Cc7ccoc7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H60N2O3/c1-34(2)15-17-39(33(42)43-9)18-16-37(6)27(28(39)22-34)10-11-31-36(5)23-29-32(35(3,4)30(36)12-14-38(31,37)7)40(8)19-20-41(29)24-26-13-21-44-25-26/h10,13,21,25,28-32H,11-12,14-20,22-24H2,1-9H3/t28?,29-,30?,31?,32-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=LTQFVLSXFUWCJS-JIXNTIAGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.