* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y02A010 |
| English Synonyms: | WUXI-NATURAL 103_Y02A010 |
| MDL Number.: | MFCD21334058 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cc1ccc(cc1)CN2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C |
| InChi: | InChI=1S/C42H64N2O2/c1-28-11-13-29(14-12-28)27-44-24-23-43(9)35-32(44)26-39(6)33(38(35,4)5)17-18-41(8)34(39)16-15-30-31-25-37(2,3)19-21-42(31,36(45)46-10)22-20-40(30,41)7/h11-15,31-35H,16-27H2,1-10H3/t31?,32-,33?,34?,35-,39+,40-,41-,42+/m1/s1 |
| InChiKey: | InChIKey=LYPLXOAGTVLYRC-SNHVRQNRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.