* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A013 |
English Synonyms: | WUXI-NATURAL 103_Y02A013 |
MDL Number.: | MFCD21334061 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1cc(cc(c1)CN2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C)C |
InChi: | InChI=1S/C43H66N2O2/c1-28-22-29(2)24-30(23-28)27-45-21-20-44(10)36-33(45)26-40(7)34(39(36,5)6)14-15-42(9)35(40)13-12-31-32-25-38(3,4)16-18-43(32,37(46)47-11)19-17-41(31,42)8/h12,22-24,32-36H,13-21,25-27H2,1-11H3/t32?,33-,34?,35?,36-,40+,41-,42-,43+/m1/s1 |
InChiKey: | InChIKey=CZLWFFYQDXZAIE-QBQDSULQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.