* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y02A019 |
| English Synonyms: | WUXI-NATURAL 103_Y02A019 |
| MDL Number.: | MFCD21334067 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cc1cccc(n1)CN2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C |
| InChi: | InChI=1S/C41H63N3O2/c1-27-12-11-13-28(42-27)26-44-23-22-43(9)34-31(44)25-38(6)32(37(34,4)5)16-17-40(8)33(38)15-14-29-30-24-36(2,3)18-20-41(30,35(45)46-10)21-19-39(29,40)7/h11-14,30-34H,15-26H2,1-10H3/t30?,31-,32?,33?,34-,38+,39-,40-,41+/m1/s1 |
| InChiKey: | InChIKey=QXUFVWFSVGBLBE-NTXKOIRTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.