* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A024 |
English Synonyms: | WUXI-NATURAL 103_Y02A024 |
MDL Number.: | MFCD21334072 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6c7cc(ncn7)OC)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H60N4O3/c1-34(2)15-17-39(33(44)46-10)18-16-37(6)25(26(39)22-34)11-12-29-36(5)23-27-32(35(3,4)28(36)13-14-38(29,37)7)42(8)19-20-43(27)30-21-31(45-9)41-24-40-30/h11,21,24,26-29,32H,12-20,22-23H2,1-10H3/t26?,27-,28?,29?,32-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=UOOZCZQCJSVWLH-OCAQCEQJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.