* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A025 |
English Synonyms: | WUXI-NATURAL 103_Y02A025 |
MDL Number.: | MFCD21334073 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)c7ccco7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H58N2O4/c1-34(2)16-18-39(33(43)44-9)19-17-37(6)25(26(39)23-34)12-13-30-36(5)24-27-31(35(3,4)29(36)14-15-38(30,37)7)40(8)20-21-41(27)32(42)28-11-10-22-45-28/h10-12,22,26-27,29-31H,13-21,23-24H2,1-9H3/t26?,27-,29?,30?,31-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=LFEJNVJJLVERBE-OUUDAJGDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.