* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A026 |
English Synonyms: | WUXI-NATURAL 103_Y02A026 |
MDL Number.: | MFCD21334074 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)c7ccoc7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H58N2O4/c1-34(2)15-17-39(33(43)44-9)18-16-37(6)26(27(39)22-34)10-11-30-36(5)23-28-31(35(3,4)29(36)12-14-38(30,37)7)40(8)19-20-41(28)32(42)25-13-21-45-24-25/h10,13,21,24,27-31H,11-12,14-20,22-23H2,1-9H3/t27?,28-,29?,30?,31-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=GZYVQCMUEXIOMO-GOMKGDIXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.