* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A029 |
English Synonyms: | WUXI-NATURAL 103_Y02A029 |
MDL Number.: | MFCD21334077 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | Cc1c(cno1)C(=O)N2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C |
InChi: | InChI=1S/C39H59N3O4/c1-24-25(23-40-46-24)32(43)42-20-19-41(9)31-28(42)22-36(6)29(35(31,4)5)13-14-38(8)30(36)12-11-26-27-21-34(2,3)15-17-39(27,33(44)45-10)18-16-37(26,38)7/h11,23,27-31H,12-22H2,1-10H3/t27?,28-,29?,30?,31-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=DYYHGJJFIZVCFY-GOMKGDIXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.