* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A030 |
English Synonyms: | WUXI-NATURAL 103_Y02A030 |
MDL Number.: | MFCD21334078 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)c7cscn7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C38H57N3O3S/c1-33(2)14-16-38(32(43)44-9)17-15-36(6)24(25(38)20-33)10-11-29-35(5)21-27-30(34(3,4)28(35)12-13-37(29,36)7)40(8)18-19-41(27)31(42)26-22-45-23-39-26/h10,22-23,25,27-30H,11-21H2,1-9H3/t25?,27-,28?,29?,30-,35+,36-,37-,38+/m1/s1 |
InChiKey: | InChIKey=ZHAHCSCCAJHSPC-KAZTTZCNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.