* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A035 |
English Synonyms: | WUXI-NATURAL 103_Y02A035 |
MDL Number.: | MFCD21334083 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | Cc1ccc(cn1)C(=O)N2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C |
InChi: | InChI=1S/C41H61N3O3/c1-26-11-12-27(25-42-26)34(45)44-22-21-43(9)33-30(44)24-38(6)31(37(33,4)5)15-16-40(8)32(38)14-13-28-29-23-36(2,3)17-19-41(29,35(46)47-10)20-18-39(28,40)7/h11-13,25,29-33H,14-24H2,1-10H3/t29?,30-,31?,32?,33-,38+,39-,40-,41+/m1/s1 |
InChiKey: | InChIKey=PVVVPFCBHCLFEI-WRRLSNBZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.