* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A038 |
English Synonyms: | WUXI-NATURAL 103_Y02A038 |
MDL Number.: | MFCD21334086 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)Cc7ccccc7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C42H62N2O3/c1-37(2)19-21-42(36(46)47-9)22-20-40(6)29(30(42)26-37)15-16-33-39(5)27-31-35(38(3,4)32(39)17-18-41(33,40)7)43(8)23-24-44(31)34(45)25-28-13-11-10-12-14-28/h10-15,30-33,35H,16-27H2,1-9H3/t30?,31-,32?,33?,35-,39+,40-,41-,42+/m1/s1 |
InChiKey: | InChIKey=LUSQOIXJXLUPGV-FCBCBWDHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.