* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y02A039 |
| English Synonyms: | WUXI-NATURAL 103_Y02A039 |
| MDL Number.: | MFCD21334087 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)Cc7cccc(c7)F)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C42H61FN2O3/c1-37(2)17-19-42(36(47)48-9)20-18-40(6)29(30(42)25-37)13-14-33-39(5)26-31-35(38(3,4)32(39)15-16-41(33,40)7)44(8)21-22-45(31)34(46)24-27-11-10-12-28(43)23-27/h10-13,23,30-33,35H,14-22,24-26H2,1-9H3/t30?,31-,32?,33?,35-,39+,40-,41-,42+/m1/s1 |
| InChiKey: | InChIKey=HVAQKEQYTPPLFZ-FCBCBWDHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.