* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y02A040 |
| English Synonyms: | WUXI-NATURAL 103_Y02A040 |
| MDL Number.: | MFCD21334088 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)Cc7ccc(cc7)OC)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C43H64N2O4/c1-38(2)19-21-43(37(47)49-10)22-20-41(6)30(31(43)26-38)15-16-34-40(5)27-32-36(39(3,4)33(40)17-18-42(34,41)7)44(8)23-24-45(32)35(46)25-28-11-13-29(48-9)14-12-28/h11-15,31-34,36H,16-27H2,1-10H3/t31?,32-,33?,34?,36-,40+,41-,42-,43+/m1/s1 |
| InChiKey: | InChIKey=NSVBIVILPQDEHF-OGOVXDSSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.