* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A055 |
English Synonyms: | WUXI-NATURAL 103_Y02A055 |
MDL Number.: | MFCD21334103 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1cc(cc(c1)C(=O)N2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C)C |
InChi: | InChI=1S/C43H64N2O3/c1-27-22-28(2)24-29(23-27)36(46)45-21-20-44(10)35-32(45)26-40(7)33(39(35,5)6)14-15-42(9)34(40)13-12-30-31-25-38(3,4)16-18-43(31,37(47)48-11)19-17-41(30,42)8/h12,22-24,31-35H,13-21,25-26H2,1-11H3/t31?,32-,33?,34?,35-,40+,41-,42-,43+/m1/s1 |
InChiKey: | InChIKey=LYNGSDFJAUUCCT-ZMVZBWSHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.