* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y02A057 |
| English Synonyms: | WUXI-NATURAL 103_Y02A057 |
| MDL Number.: | MFCD21334105 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)c7ccccc7F)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C41H59FN2O3/c1-36(2)18-20-41(35(46)47-9)21-19-39(6)27(28(41)24-36)14-15-32-38(5)25-30-33(37(3,4)31(38)16-17-40(32,39)7)43(8)22-23-44(30)34(45)26-12-10-11-13-29(26)42/h10-14,28,30-33H,15-25H2,1-9H3/t28?,30-,31?,32?,33-,38+,39-,40-,41+/m1/s1 |
| InChiKey: | InChIKey=JPIZYUCROOBGAQ-PRVDHORSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.